C27H40N2O3 — CID 3347654
N-tert-butyl-2-ethyl-N-[2-[furan-2-ylmethyl(2-phenylethyl)amino]-2-oxoethyl]hexanamide (PubChem CID 3347654) has the molecular formula C27H40N2O3 and a molecular weight of 440.63 g/mol. Its IUPAC name is N-tert-butyl-2-ethyl-N-[2-[furan-2-ylmethyl(2-phenylethyl)amino]-2-oxoethyl]hexanamide.
| Compound Name | N-tert-butyl-2-ethyl-N-[2-[furan-2-ylmethyl(2-phenylethyl)amino]-2-oxoethyl]hexanamide |
|---|---|
| PubChem CID | 3347654 |
| Molecular Formula | C27H40N2O3 |
| Molecular Weight | 440.63 g/mol |
| Exact Mass | 440.30 |
| IUPAC Name | N-tert-butyl-2-ethyl-N-[2-[furan-2-ylmethyl(2-phenylethyl)amino]-2-oxoethyl]hexanamide |
| SMILES | CCCCC(CC)C(=O)N(CC(=O)N(CCc1ccccc1)Cc1ccco1)C(C)(C)C |
| InChI | InChI=1S/C27H40N2O3/c1-6-8-15-23(7-2)26(31)29(27(3,4)5)21-25(30)28(20-24-16-12-19-32-24)18-17-22-13-10-9-11-14-22/h9-14,16,19,23H,6-8,15,17-18,20-21H2,1-5H3 |
| InChIKey | KFPILQJCQMFVCY-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.63 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |