C27H31N3O7 — CID 3900240
N-[2-[2-(3,4-dimethoxyphenyl)ethyl-(furan-2-ylmethyl)amino]-2-oxoethyl]-3-nitro-N-propan-2-ylbenzamide (PubChem CID 3900240) has the molecular formula C27H31N3O7 and a molecular weight of 509.56 g/mol. Its IUPAC name is N-[2-[2-(3,4-dimethoxyphenyl)ethyl-(furan-2-ylmethyl)amino]-2-oxoethyl]-3-nitro-N-propan-2-ylbenzamide.
| Compound Name | N-[2-[2-(3,4-dimethoxyphenyl)ethyl-(furan-2-ylmethyl)amino]-2-oxoethyl]-3-nitro-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 3900240 |
| Molecular Formula | C27H31N3O7 |
| Molecular Weight | 509.56 g/mol |
| Exact Mass | 509.22 |
| IUPAC Name | N-[2-[2-(3,4-dimethoxyphenyl)ethyl-(furan-2-ylmethyl)amino]-2-oxoethyl]-3-nitro-N-propan-2-ylbenzamide |
| SMILES | COc1ccc(CCN(Cc2ccco2)C(=O)CN(C(=O)c2cccc([N+](=O)[O-])c2)C(C)C)cc1OC |
| InChI | InChI=1S/C27H31N3O7/c1-19(2)29(27(32)21-7-5-8-22(16-21)30(33)34)18-26(31)28(17-23-9-6-14-37-23)13-12-20-10-11-24(35-3)25(15-20)36-4/h5-11,14-16,19H,12-13,17-18H2,1-4H3 |
| InChIKey | QZVBYGNTDGFFCW-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 115.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.56 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|