C22H30N5OS+ — CID 135553106
(3-cyclopentyl-4,5-dimethyl-2-sulfanylideneimidazol-1-yl)methyl-ethyl-[(4-oxo-3H-quinazolin-2-yl)methyl]azanium (PubChem CID 135553106) has the molecular formula C22H30N5OS+ and a molecular weight of 412.58 g/mol. Its IUPAC name is (3-cyclopentyl-4,5-dimethyl-2-sulfanylideneimidazol-1-yl)methyl-ethyl-[(4-oxo-3H-quinazolin-2-yl)methyl]azanium.
| Compound Name | (3-cyclopentyl-4,5-dimethyl-2-sulfanylideneimidazol-1-yl)methyl-ethyl-[(4-oxo-3H-quinazolin-2-yl)methyl]azanium |
|---|---|
| PubChem CID | 135553106 |
| Molecular Formula | C22H30N5OS+ |
| Molecular Weight | 412.58 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | (3-cyclopentyl-4,5-dimethyl-2-sulfanylideneimidazol-1-yl)methyl-ethyl-[(4-oxo-3H-quinazolin-2-yl)methyl]azanium |
| SMILES | CC[NH+](Cc1nc2ccccc2c(=O)[nH]1)Cn1c(C)c(C)n(C2CCCC2)c1=S |
| InChI | InChI=1S/C22H29N5OS/c1-4-25(13-20-23-19-12-8-7-11-18(19)21(28)24-20)14-26-15(2)16(3)27(22(26)29)17-9-5-6-10-17/h7-8,11-12,17H,4-6,9-10,13-14H2,1-3H3,(H,23,24,28)/p+1 |
| InChIKey | NFSNVIKWUDRSOY-UHFFFAOYSA-O |
| XLogP | 3.05 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.58 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|