C16H17N5OS — CID 135500620
2-(4-cyclohexyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-3H-quinazolin-4-one (PubChem CID 135500620) has the molecular formula C16H17N5OS and a molecular weight of 327.41 g/mol. Its IUPAC name is 2-(4-cyclohexyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-3H-quinazolin-4-one.
| Compound Name | 2-(4-cyclohexyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135500620 |
| Molecular Formula | C16H17N5OS |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | 2-(4-cyclohexyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-3H-quinazolin-4-one |
| SMILES | O=c1[nH]c(-c2n[nH]c(=S)n2C2CCCCC2)nc2ccccc12 |
| InChI | InChI=1S/C16H17N5OS/c22-15-11-8-4-5-9-12(11)17-13(18-15)14-19-20-16(23)21(14)10-6-2-1-3-7-10/h4-5,8-10H,1-3,6-7H2,(H,20,23)(H,17,18,22) |
| InChIKey | JOVLCGSNTHHJIV-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 79.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|