C10H6N4OS2 — CID 165178436
2-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)-3H-quinazolin-4-one (PubChem CID 165178436) has the molecular formula C10H6N4OS2 and a molecular weight of 262.32 g/mol. Its IUPAC name is 2-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)-3H-quinazolin-4-one.
| Compound Name | 2-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 165178436 |
| Molecular Formula | C10H6N4OS2 |
| Molecular Weight | 262.32 g/mol |
| Exact Mass | 262.00 |
| IUPAC Name | 2-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)-3H-quinazolin-4-one |
| SMILES | O=c1[nH]c(-c2n[nH]c(=S)s2)nc2ccccc12 |
| InChI | InChI=1S/C10H6N4OS2/c15-8-5-3-1-2-4-6(5)11-7(12-8)9-13-14-10(16)17-9/h1-4H,(H,14,16)(H,11,12,15) |
| InChIKey | BEYNHZQGLUJUFE-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.32 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|