C17H21N6OS2+ — CID 135751791
ethyl-[(4-oxo-3H-quinazolin-2-yl)methyl]-[[5-(prop-2-enylamino)-2-sulfanylidene-1,3,4-thiadiazol-3-yl]methyl]azanium (PubChem CID 135751791) has the molecular formula C17H21N6OS2+ and a molecular weight of 389.53 g/mol. Its IUPAC name is ethyl-[(4-oxo-3H-quinazolin-2-yl)methyl]-[[5-(prop-2-enylamino)-2-sulfanylidene-1,3,4-thiadiazol-3-yl]methyl]azanium.
| Compound Name | ethyl-[(4-oxo-3H-quinazolin-2-yl)methyl]-[[5-(prop-2-enylamino)-2-sulfanylidene-1,3,4-thiadiazol-3-yl]methyl]azanium |
|---|---|
| PubChem CID | 135751791 |
| Molecular Formula | C17H21N6OS2+ |
| Molecular Weight | 389.53 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | ethyl-[(4-oxo-3H-quinazolin-2-yl)methyl]-[[5-(prop-2-enylamino)-2-sulfanylidene-1,3,4-thiadiazol-3-yl]methyl]azanium |
| SMILES | C=CCNc1nn(C[NH+](CC)Cc2nc3ccccc3c(=O)[nH]2)c(=S)s1 |
| InChI | InChI=1S/C17H20N6OS2/c1-3-9-18-16-21-23(17(25)26-16)11-22(4-2)10-14-19-13-8-6-5-7-12(13)15(24)20-14/h3,5-8H,1,4,9-11H2,2H3,(H,18,21)(H,19,20,24)/p+1 |
| InChIKey | XQZRSWXBUIJHFG-UHFFFAOYSA-O |
| XLogP | 1.57 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.53 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|