C19H21N5O4 — CID 135599212
2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-methyl-N-[(4-oxo-3H-quinazolin-2-yl)methyl]acetamide (PubChem CID 135599212) has the molecular formula C19H21N5O4 and a molecular weight of 383.41 g/mol. Its IUPAC name is 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-methyl-N-[(4-oxo-3H-quinazolin-2-yl)methyl]acetamide.
| Compound Name | 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-methyl-N-[(4-oxo-3H-quinazolin-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 135599212 |
| Molecular Formula | C19H21N5O4 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-methyl-N-[(4-oxo-3H-quinazolin-2-yl)methyl]acetamide |
| SMILES | CN(Cc1nc2ccccc2c(=O)[nH]1)C(=O)CN1C(=O)NC2(CCCC2)C1=O |
| InChI | InChI=1S/C19H21N5O4/c1-23(10-14-20-13-7-3-2-6-12(13)16(26)21-14)15(25)11-24-17(27)19(22-18(24)28)8-4-5-9-19/h2-3,6-7H,4-5,8-11H2,1H3,(H,22,28)(H,20,21,26) |
| InChIKey | FCVCAEKYYZYHMM-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 115.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|