C23H29N5O4 — CID 136749492
N-methyl-N-[(4-oxo-3H-quinazolin-2-yl)methyl]-2-[(5R,9S)-7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetamide (PubChem CID 136749492) has the molecular formula C23H29N5O4 and a molecular weight of 439.52 g/mol. Its IUPAC name is N-methyl-N-[(4-oxo-3H-quinazolin-2-yl)methyl]-2-[(5R,9S)-7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetamide.
| Compound Name | N-methyl-N-[(4-oxo-3H-quinazolin-2-yl)methyl]-2-[(5R,9S)-7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetamide |
|---|---|
| PubChem CID | 136749492 |
| Molecular Formula | C23H29N5O4 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.22 |
| IUPAC Name | N-methyl-N-[(4-oxo-3H-quinazolin-2-yl)methyl]-2-[(5R,9S)-7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetamide |
| SMILES | C[C@H]1CC(C)(C)C[C@@]2(C1)NC(=O)N(CC(=O)N(C)Cc1nc3ccccc3c(=O)[nH]1)C2=O |
| InChI | InChI=1S/C23H29N5O4/c1-14-9-22(2,3)13-23(10-14)20(31)28(21(32)26-23)12-18(29)27(4)11-17-24-16-8-6-5-7-15(16)19(30)25-17/h5-8,14H,9-13H2,1-4H3,(H,26,32)(H,24,25,30)/t14-,23+/m0/s1 |
| InChIKey | IZIYRWYHQVRMHC-LFVRLGFBSA-N |
| XLogP | 2.02 |
| TPSA | 115.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|