C16H21N3O2 — CID 114334567
3-(4-phenylbutyl)-1,3,7-triazaspiro[4.4]nonane-2,4-dione (PubChem CID 114334567) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is 3-(4-phenylbutyl)-1,3,7-triazaspiro[4.4]nonane-2,4-dione.
| Compound Name | 3-(4-phenylbutyl)-1,3,7-triazaspiro[4.4]nonane-2,4-dione |
|---|---|
| PubChem CID | 114334567 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 3-(4-phenylbutyl)-1,3,7-triazaspiro[4.4]nonane-2,4-dione |
| SMILES | O=C1NC2(CCNC2)C(=O)N1CCCCc1ccccc1 |
| InChI | InChI=1S/C16H21N3O2/c20-14-16(9-10-17-12-16)18-15(21)19(14)11-5-4-8-13-6-2-1-3-7-13/h1-3,6-7,17H,4-5,8-12H2,(H,18,21) |
| InChIKey | HUWWFBGRRJYBSA-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|