C17H22FN3O4S — CID 32678207
N-[3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propyl]-1-(4-fluorophenyl)methanesulfonamide (PubChem CID 32678207) has the molecular formula C17H22FN3O4S and a molecular weight of 383.45 g/mol. Its IUPAC name is N-[3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propyl]-1-(4-fluorophenyl)methanesulfonamide.
| Compound Name | N-[3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propyl]-1-(4-fluorophenyl)methanesulfonamide |
|---|---|
| PubChem CID | 32678207 |
| Molecular Formula | C17H22FN3O4S |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | N-[3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propyl]-1-(4-fluorophenyl)methanesulfonamide |
| SMILES | O=C1NC2(CCCC2)C(=O)N1CCCNS(=O)(=O)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C17H22FN3O4S/c18-14-6-4-13(5-7-14)12-26(24,25)19-10-3-11-21-15(22)17(20-16(21)23)8-1-2-9-17/h4-7,19H,1-3,8-12H2,(H,20,23) |
| InChIKey | AMYAMYQKVGDPES-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|