C14H22FNO2S — CID 110421113
N-(4,4-dimethylpentyl)-1-(4-fluorophenyl)methanesulfonamide (PubChem CID 110421113) has the molecular formula C14H22FNO2S and a molecular weight of 287.40 g/mol. Its IUPAC name is N-(4,4-dimethylpentyl)-1-(4-fluorophenyl)methanesulfonamide.
| Compound Name | N-(4,4-dimethylpentyl)-1-(4-fluorophenyl)methanesulfonamide |
|---|---|
| PubChem CID | 110421113 |
| Molecular Formula | C14H22FNO2S |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | N-(4,4-dimethylpentyl)-1-(4-fluorophenyl)methanesulfonamide |
| SMILES | CC(C)(C)CCCNS(=O)(=O)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C14H22FNO2S/c1-14(2,3)9-4-10-16-19(17,18)11-12-5-7-13(15)8-6-12/h5-8,16H,4,9-11H2,1-3H3 |
| InChIKey | RINHNWREMMUJBE-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|