C15H25NO2S — CID 110421112
N-(4,4-dimethylpentyl)-1-(3-methylphenyl)methanesulfonamide (PubChem CID 110421112) has the molecular formula C15H25NO2S and a molecular weight of 283.44 g/mol. Its IUPAC name is N-(4,4-dimethylpentyl)-1-(3-methylphenyl)methanesulfonamide.
| Compound Name | N-(4,4-dimethylpentyl)-1-(3-methylphenyl)methanesulfonamide |
|---|---|
| PubChem CID | 110421112 |
| Molecular Formula | C15H25NO2S |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | N-(4,4-dimethylpentyl)-1-(3-methylphenyl)methanesulfonamide |
| SMILES | Cc1cccc(CS(=O)(=O)NCCCC(C)(C)C)c1 |
| InChI | InChI=1S/C15H25NO2S/c1-13-7-5-8-14(11-13)12-19(17,18)16-10-6-9-15(2,3)4/h5,7-8,11,16H,6,9-10,12H2,1-4H3 |
| InChIKey | IZVDKDVQQOTIRD-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|