C15H24FN — CID 114209362
N-[2-(4-fluorophenyl)ethyl]-4,4-dimethylpentan-1-amine (PubChem CID 114209362) has the molecular formula C15H24FN and a molecular weight of 237.36 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)ethyl]-4,4-dimethylpentan-1-amine.
| Compound Name | N-[2-(4-fluorophenyl)ethyl]-4,4-dimethylpentan-1-amine |
|---|---|
| PubChem CID | 114209362 |
| Molecular Formula | C15H24FN |
| Molecular Weight | 237.36 g/mol |
| Exact Mass | 237.19 |
| IUPAC Name | N-[2-(4-fluorophenyl)ethyl]-4,4-dimethylpentan-1-amine |
| SMILES | CC(C)(C)CCCNCCc1ccc(F)cc1 |
| InChI | InChI=1S/C15H24FN/c1-15(2,3)10-4-11-17-12-9-13-5-7-14(16)8-6-13/h5-8,17H,4,9-12H2,1-3H3 |
| InChIKey | UAENLJMYBSBUIV-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.36 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|