C21H22FN4O4+ — CID 9285740
cyclopropyl-[(4-fluorophenyl)methyl]-[[(4R)-4-methyl-4-(4-nitrophenyl)-2,5-dioxoimidazolidin-1-yl]methyl]azanium (PubChem CID 9285740) has the molecular formula C21H22FN4O4+ and a molecular weight of 413.43 g/mol. Its IUPAC name is cyclopropyl-[(4-fluorophenyl)methyl]-[[(4R)-4-methyl-4-(4-nitrophenyl)-2,5-dioxoimidazolidin-1-yl]methyl]azanium.
| Compound Name | cyclopropyl-[(4-fluorophenyl)methyl]-[[(4R)-4-methyl-4-(4-nitrophenyl)-2,5-dioxoimidazolidin-1-yl]methyl]azanium |
|---|---|
| PubChem CID | 9285740 |
| Molecular Formula | C21H22FN4O4+ |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | cyclopropyl-[(4-fluorophenyl)methyl]-[[(4R)-4-methyl-4-(4-nitrophenyl)-2,5-dioxoimidazolidin-1-yl]methyl]azanium |
| SMILES | C[C@]1(c2ccc([N+](=O)[O-])cc2)NC(=O)N(C[NH+](Cc2ccc(F)cc2)C2CC2)C1=O |
| InChI | InChI=1S/C21H21FN4O4/c1-21(15-4-8-18(9-5-15)26(29)30)19(27)25(20(28)23-21)13-24(17-10-11-17)12-14-2-6-16(22)7-3-14/h2-9,17H,10-13H2,1H3,(H,23,28)/p+1/t21-/m1/s1 |
| InChIKey | HNRUBDSJKNLZSX-OAQYLSRUSA-O |
| XLogP | 1.71 |
| TPSA | 96.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|