C23H32FN3O3 — CID 46599435
N-[(4-fluorophenyl)methyl]-2-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-pentylacetamide (PubChem CID 46599435) has the molecular formula C23H32FN3O3 and a molecular weight of 417.53 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-2-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-pentylacetamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-2-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-pentylacetamide |
|---|---|
| PubChem CID | 46599435 |
| Molecular Formula | C23H32FN3O3 |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-2-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-pentylacetamide |
| SMILES | CCCCCN(Cc1ccc(F)cc1)C(=O)CN1C(=O)NC2(CCC(C)CC2)C1=O |
| InChI | InChI=1S/C23H32FN3O3/c1-3-4-5-14-26(15-18-6-8-19(24)9-7-18)20(28)16-27-21(29)23(25-22(27)30)12-10-17(2)11-13-23/h6-9,17H,3-5,10-16H2,1-2H3,(H,25,30) |
| InChIKey | WJXABFKWVHTUSB-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|