C22H31N3O3 — CID 9401594
2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)-N-[(4-methylphenyl)methyl]-N-propylacetamide (PubChem CID 9401594) has the molecular formula C22H31N3O3 and a molecular weight of 385.51 g/mol. Its IUPAC name is 2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)-N-[(4-methylphenyl)methyl]-N-propylacetamide.
| Compound Name | 2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)-N-[(4-methylphenyl)methyl]-N-propylacetamide |
|---|---|
| PubChem CID | 9401594 |
| Molecular Formula | C22H31N3O3 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | 2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)-N-[(4-methylphenyl)methyl]-N-propylacetamide |
| SMILES | CCCN(Cc1ccc(C)cc1)C(=O)CN1C(=O)NC2(CCCCCC2)C1=O |
| InChI | InChI=1S/C22H31N3O3/c1-3-14-24(15-18-10-8-17(2)9-11-18)19(26)16-25-20(27)22(23-21(25)28)12-6-4-5-7-13-22/h8-11H,3-7,12-16H2,1-2H3,(H,23,28) |
| InChIKey | ZNXCQTRGVPIRAW-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|