C27H29N3O3 — CID 46606420
2-(4-methyl-4-naphthalen-1-yl-2,5-dioxoimidazolidin-1-yl)-N-[(4-methylphenyl)methyl]-N-propylacetamide (PubChem CID 46606420) has the molecular formula C27H29N3O3 and a molecular weight of 443.55 g/mol. Its IUPAC name is 2-(4-methyl-4-naphthalen-1-yl-2,5-dioxoimidazolidin-1-yl)-N-[(4-methylphenyl)methyl]-N-propylacetamide.
| Compound Name | 2-(4-methyl-4-naphthalen-1-yl-2,5-dioxoimidazolidin-1-yl)-N-[(4-methylphenyl)methyl]-N-propylacetamide |
|---|---|
| PubChem CID | 46606420 |
| Molecular Formula | C27H29N3O3 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | 2-(4-methyl-4-naphthalen-1-yl-2,5-dioxoimidazolidin-1-yl)-N-[(4-methylphenyl)methyl]-N-propylacetamide |
| SMILES | CCCN(Cc1ccc(C)cc1)C(=O)CN1C(=O)NC(C)(c2cccc3ccccc23)C1=O |
| InChI | InChI=1S/C27H29N3O3/c1-4-16-29(17-20-14-12-19(2)13-15-20)24(31)18-30-25(32)27(3,28-26(30)33)23-11-7-9-21-8-5-6-10-22(21)23/h5-15H,4,16-18H2,1-3H3,(H,28,33) |
| InChIKey | MDRJZMFHMWNBHA-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|