C25H24N2O3 — CID 7179916
(5S)-5-methyl-5-naphthalen-1-yl-3-[2-oxo-2-(4-propylphenyl)ethyl]imidazolidine-2,4-dione (PubChem CID 7179916) has the molecular formula C25H24N2O3 and a molecular weight of 400.48 g/mol. Its IUPAC name is (5S)-5-methyl-5-naphthalen-1-yl-3-[2-oxo-2-(4-propylphenyl)ethyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-methyl-5-naphthalen-1-yl-3-[2-oxo-2-(4-propylphenyl)ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 7179916 |
| Molecular Formula | C25H24N2O3 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | (5S)-5-methyl-5-naphthalen-1-yl-3-[2-oxo-2-(4-propylphenyl)ethyl]imidazolidine-2,4-dione |
| SMILES | CCCc1ccc(C(=O)CN2C(=O)N[C@@](C)(c3cccc4ccccc34)C2=O)cc1 |
| InChI | InChI=1S/C25H24N2O3/c1-3-7-17-12-14-19(15-13-17)22(28)16-27-23(29)25(2,26-24(27)30)21-11-6-9-18-8-4-5-10-20(18)21/h4-6,8-15H,3,7,16H2,1-2H3,(H,26,30)/t25-/m0/s1 |
| InChIKey | WXNFYVGTZLNUHP-VWLOTQADSA-N |
| XLogP | 4.44 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|