C26H26N2O3 — CID 42971848
3-[2-(4-tert-butylphenyl)-2-oxoethyl]-5-methyl-5-naphthalen-1-ylimidazolidine-2,4-dione (PubChem CID 42971848) has the molecular formula C26H26N2O3 and a molecular weight of 414.51 g/mol. Its IUPAC name is 3-[2-(4-tert-butylphenyl)-2-oxoethyl]-5-methyl-5-naphthalen-1-ylimidazolidine-2,4-dione.
| Compound Name | 3-[2-(4-tert-butylphenyl)-2-oxoethyl]-5-methyl-5-naphthalen-1-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 42971848 |
| Molecular Formula | C26H26N2O3 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | 3-[2-(4-tert-butylphenyl)-2-oxoethyl]-5-methyl-5-naphthalen-1-ylimidazolidine-2,4-dione |
| SMILES | CC(C)(C)c1ccc(C(=O)CN2C(=O)NC(C)(c3cccc4ccccc34)C2=O)cc1 |
| InChI | InChI=1S/C26H26N2O3/c1-25(2,3)19-14-12-18(13-15-19)22(29)16-28-23(30)26(4,27-24(28)31)21-11-7-9-17-8-5-6-10-20(17)21/h5-15H,16H2,1-4H3,(H,27,31) |
| InChIKey | RPDMQGJYRNOKIW-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|