C22H23ClN2O3 — CID 55752375
3-[2-(4-tert-butylphenyl)-2-oxoethyl]-5-(3-chlorophenyl)-5-methylimidazolidine-2,4-dione (PubChem CID 55752375) has the molecular formula C22H23ClN2O3 and a molecular weight of 398.89 g/mol. Its IUPAC name is 3-[2-(4-tert-butylphenyl)-2-oxoethyl]-5-(3-chlorophenyl)-5-methylimidazolidine-2,4-dione.
| Compound Name | 3-[2-(4-tert-butylphenyl)-2-oxoethyl]-5-(3-chlorophenyl)-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 55752375 |
| Molecular Formula | C22H23ClN2O3 |
| Molecular Weight | 398.89 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 3-[2-(4-tert-butylphenyl)-2-oxoethyl]-5-(3-chlorophenyl)-5-methylimidazolidine-2,4-dione |
| SMILES | CC(C)(C)c1ccc(C(=O)CN2C(=O)NC(C)(c3cccc(Cl)c3)C2=O)cc1 |
| InChI | InChI=1S/C22H23ClN2O3/c1-21(2,3)15-10-8-14(9-11-15)18(26)13-25-19(27)22(4,24-20(25)28)16-6-5-7-17(23)12-16/h5-12H,13H2,1-4H3,(H,24,28) |
| InChIKey | URSRJYNXZSVQCG-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.89 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|