C21H17FN2O4S — CID 42982442
[2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)acetate (PubChem CID 42982442) has the molecular formula C21H17FN2O4S and a molecular weight of 412.44 g/mol. Its IUPAC name is [2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)acetate.
| Compound Name | [2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)acetate |
|---|---|
| PubChem CID | 42982442 |
| Molecular Formula | C21H17FN2O4S |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | [2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)acetate |
| SMILES | O=C(CN1C(=O)C2C3C=CC(C3)C2C1=O)OCc1csc(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C21H17FN2O4S/c22-14-5-3-11(4-6-14)19-23-15(10-29-19)9-28-16(25)8-24-20(26)17-12-1-2-13(7-12)18(17)21(24)27/h1-6,10,12-13,17-18H,7-9H2 |
| InChIKey | DSGICWCJUCANLH-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|