C15H13ClN2O3S2 — CID 9003631
[2-(4-chlorophenyl)-1,3-thiazol-4-yl]methyl 2-(2-oxo-1,3-thiazolidin-3-yl)acetate (PubChem CID 9003631) has the molecular formula C15H13ClN2O3S2 and a molecular weight of 368.87 g/mol. Its IUPAC name is [2-(4-chlorophenyl)-1,3-thiazol-4-yl]methyl 2-(2-oxo-1,3-thiazolidin-3-yl)acetate.
| Compound Name | [2-(4-chlorophenyl)-1,3-thiazol-4-yl]methyl 2-(2-oxo-1,3-thiazolidin-3-yl)acetate |
|---|---|
| PubChem CID | 9003631 |
| Molecular Formula | C15H13ClN2O3S2 |
| Molecular Weight | 368.87 g/mol |
| Exact Mass | 368.01 |
| IUPAC Name | [2-(4-chlorophenyl)-1,3-thiazol-4-yl]methyl 2-(2-oxo-1,3-thiazolidin-3-yl)acetate |
| SMILES | O=C(CN1CCSC1=O)OCc1csc(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C15H13ClN2O3S2/c16-11-3-1-10(2-4-11)14-17-12(9-23-14)8-21-13(19)7-18-5-6-22-15(18)20/h1-4,9H,5-8H2 |
| InChIKey | BOCGXSFERMXSLD-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.87 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|