C12H11N3O4S2 — CID 7632199
(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 2-(2-oxo-1,3-thiazolidin-3-yl)acetate (PubChem CID 7632199) has the molecular formula C12H11N3O4S2 and a molecular weight of 325.37 g/mol. Its IUPAC name is (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 2-(2-oxo-1,3-thiazolidin-3-yl)acetate.
| Compound Name | (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 2-(2-oxo-1,3-thiazolidin-3-yl)acetate |
|---|---|
| PubChem CID | 7632199 |
| Molecular Formula | C12H11N3O4S2 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.02 |
| IUPAC Name | (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 2-(2-oxo-1,3-thiazolidin-3-yl)acetate |
| SMILES | O=C(CN1CCSC1=O)OCc1cc(=O)n2ccsc2n1 |
| InChI | InChI=1S/C12H11N3O4S2/c16-9-5-8(13-11-15(9)2-4-20-11)7-19-10(17)6-14-1-3-21-12(14)18/h2,4-5H,1,3,6-7H2 |
| InChIKey | IOLIVWQNXWXDMQ-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 80.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|