C16H16N2O5 — CID 98700383
(3-methyl-1,2-oxazol-5-yl)methyl 2-[(1R,2R,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]acetate (PubChem CID 98700383) has the molecular formula C16H16N2O5 and a molecular weight of 316.31 g/mol. Its IUPAC name is (3-methyl-1,2-oxazol-5-yl)methyl 2-[(1R,2R,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]acetate.
| Compound Name | (3-methyl-1,2-oxazol-5-yl)methyl 2-[(1R,2R,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]acetate |
|---|---|
| PubChem CID | 98700383 |
| Molecular Formula | C16H16N2O5 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | (3-methyl-1,2-oxazol-5-yl)methyl 2-[(1R,2R,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]acetate |
| SMILES | Cc1cc(COC(=O)CN2C(=O)[C@H]3[C@H](C2=O)[C@H]2C=C[C@H]3C2)on1 |
| InChI | InChI=1S/C16H16N2O5/c1-8-4-11(23-17-8)7-22-12(19)6-18-15(20)13-9-2-3-10(5-9)14(13)16(18)21/h2-4,9-10,13-14H,5-7H2,1H3/t9-,10-,13+,14+/m0/s1 |
| InChIKey | VZWXEPAPHBGNJX-DUBDDPSESA-N |
| XLogP | 0.83 |
| TPSA | 89.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|