C16H24N2O3Si — CID 102562408
2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N-(2-trimethylsilylethyl)acetamide (PubChem CID 102562408) has the molecular formula C16H24N2O3Si and a molecular weight of 320.47 g/mol. Its IUPAC name is 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N-(2-trimethylsilylethyl)acetamide.
| Compound Name | 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N-(2-trimethylsilylethyl)acetamide |
|---|---|
| PubChem CID | 102562408 |
| Molecular Formula | C16H24N2O3Si |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N-(2-trimethylsilylethyl)acetamide |
| SMILES | C[Si](C)(C)CCNC(=O)CN1C(=O)C2C3C=CC(C3)C2C1=O |
| InChI | InChI=1S/C16H24N2O3Si/c1-22(2,3)7-6-17-12(19)9-18-15(20)13-10-4-5-11(8-10)14(13)16(18)21/h4-5,10-11,13-14H,6-9H2,1-3H3,(H,17,19) |
| InChIKey | TWHWKDHSSORBRX-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|