C16H17N3O3S — CID 75494030
2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N-[(4-methyl-1,3-thiazol-5-yl)methyl]acetamide (PubChem CID 75494030) has the molecular formula C16H17N3O3S and a molecular weight of 331.40 g/mol. Its IUPAC name is 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N-[(4-methyl-1,3-thiazol-5-yl)methyl]acetamide.
| Compound Name | 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N-[(4-methyl-1,3-thiazol-5-yl)methyl]acetamide |
|---|---|
| PubChem CID | 75494030 |
| Molecular Formula | C16H17N3O3S |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N-[(4-methyl-1,3-thiazol-5-yl)methyl]acetamide |
| SMILES | Cc1ncsc1CNC(=O)CN1C(=O)C2C3C=CC(C3)C2C1=O |
| InChI | InChI=1S/C16H17N3O3S/c1-8-11(23-7-18-8)5-17-12(20)6-19-15(21)13-9-2-3-10(4-9)14(13)16(19)22/h2-3,7,9-10,13-14H,4-6H2,1H3,(H,17,20) |
| InChIKey | ZSBLVKBXTPBGQW-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|