C24H30N2O6 — CID 132989827
[(1R,4S,7R)-3-acetyl-1,4,5,6,7-pentamethyl-2-oxa-3-azabicyclo[2.2.1]hept-5-en-7-yl]methyl 2-[(1S,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]acetate (PubChem CID 132989827) has the molecular formula C24H30N2O6 and a molecular weight of 442.51 g/mol. Its IUPAC name is [(1R,4S,7R)-3-acetyl-1,4,5,6,7-pentamethyl-2-oxa-3-azabicyclo[2.2.1]hept-5-en-7-yl]methyl 2-[(1S,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]acetate.
| Compound Name | [(1R,4S,7R)-3-acetyl-1,4,5,6,7-pentamethyl-2-oxa-3-azabicyclo[2.2.1]hept-5-en-7-yl]methyl 2-[(1S,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]acetate |
|---|---|
| PubChem CID | 132989827 |
| Molecular Formula | C24H30N2O6 |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | [(1R,4S,7R)-3-acetyl-1,4,5,6,7-pentamethyl-2-oxa-3-azabicyclo[2.2.1]hept-5-en-7-yl]methyl 2-[(1S,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]acetate |
| SMILES | CC(=O)N1O[C@]2(C)C(C)=C(C)[C@@]1(C)[C@]2(C)COC(=O)CN1C(=O)[C@@H]2[C@H](C1=O)[C@H]1C=C[C@@H]2C1 |
| InChI | InChI=1S/C24H30N2O6/c1-12-13(2)24(6)22(4,23(12,5)26(32-24)14(3)27)11-31-17(28)10-25-20(29)18-15-7-8-16(9-15)19(18)21(25)30/h7-8,15-16,18-19H,9-11H2,1-6H3/t15-,16+,18+,19-,22-,23-,24+/m0/s1 |
| InChIKey | ZATCYJXXQHRBNN-BSQFCTLSSA-N |
| XLogP | 2.00 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|