C15H9ClN2O6 — CID 16869649
[5-(4-chlorophenyl)-1,2-oxazol-3-yl]methyl 5-nitrofuran-2-carboxylate (PubChem CID 16869649) has the molecular formula C15H9ClN2O6 and a molecular weight of 348.70 g/mol. Its IUPAC name is [5-(4-chlorophenyl)-1,2-oxazol-3-yl]methyl 5-nitrofuran-2-carboxylate.
| Compound Name | [5-(4-chlorophenyl)-1,2-oxazol-3-yl]methyl 5-nitrofuran-2-carboxylate |
|---|---|
| PubChem CID | 16869649 |
| Molecular Formula | C15H9ClN2O6 |
| Molecular Weight | 348.70 g/mol |
| Exact Mass | 348.01 |
| IUPAC Name | [5-(4-chlorophenyl)-1,2-oxazol-3-yl]methyl 5-nitrofuran-2-carboxylate |
| SMILES | O=C(OCc1cc(-c2ccc(Cl)cc2)on1)c1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C15H9ClN2O6/c16-10-3-1-9(2-4-10)13-7-11(17-24-13)8-22-15(19)12-5-6-14(23-12)18(20)21/h1-7H,8H2 |
| InChIKey | XXNKCSGTTIHUID-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 108.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.70 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|