C17H11ClFNO3 — CID 16869687
[5-(4-fluorophenyl)-1,2-oxazol-3-yl]methyl 4-chlorobenzoate (PubChem CID 16869687) has the molecular formula C17H11ClFNO3 and a molecular weight of 331.73 g/mol. Its IUPAC name is [5-(4-fluorophenyl)-1,2-oxazol-3-yl]methyl 4-chlorobenzoate.
| Compound Name | [5-(4-fluorophenyl)-1,2-oxazol-3-yl]methyl 4-chlorobenzoate |
|---|---|
| PubChem CID | 16869687 |
| Molecular Formula | C17H11ClFNO3 |
| Molecular Weight | 331.73 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | [5-(4-fluorophenyl)-1,2-oxazol-3-yl]methyl 4-chlorobenzoate |
| SMILES | O=C(OCc1cc(-c2ccc(F)cc2)on1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H11ClFNO3/c18-13-5-1-12(2-6-13)17(21)22-10-15-9-16(23-20-15)11-3-7-14(19)8-4-11/h1-9H,10H2 |
| InChIKey | UFOXARQIZFBSSC-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.73 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |