C20H19NO3 — CID 16869420
[5-(4-methylphenyl)-1,2-oxazol-3-yl]methyl 3,5-dimethylbenzoate (PubChem CID 16869420) has the molecular formula C20H19NO3 and a molecular weight of 321.38 g/mol. Its IUPAC name is [5-(4-methylphenyl)-1,2-oxazol-3-yl]methyl 3,5-dimethylbenzoate.
| Compound Name | [5-(4-methylphenyl)-1,2-oxazol-3-yl]methyl 3,5-dimethylbenzoate |
|---|---|
| PubChem CID | 16869420 |
| Molecular Formula | C20H19NO3 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | [5-(4-methylphenyl)-1,2-oxazol-3-yl]methyl 3,5-dimethylbenzoate |
| SMILES | Cc1ccc(-c2cc(COC(=O)c3cc(C)cc(C)c3)no2)cc1 |
| InChI | InChI=1S/C20H19NO3/c1-13-4-6-16(7-5-13)19-11-18(21-24-19)12-23-20(22)17-9-14(2)8-15(3)10-17/h4-11H,12H2,1-3H3 |
| InChIKey | CGVIKAVCBSICCF-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |