C19H16ClNO3S — CID 16869606
[5-(4-chlorophenyl)-1,2-oxazol-3-yl]methyl 2-benzylsulfanylacetate (PubChem CID 16869606) has the molecular formula C19H16ClNO3S and a molecular weight of 373.86 g/mol. Its IUPAC name is [5-(4-chlorophenyl)-1,2-oxazol-3-yl]methyl 2-benzylsulfanylacetate.
| Compound Name | [5-(4-chlorophenyl)-1,2-oxazol-3-yl]methyl 2-benzylsulfanylacetate |
|---|---|
| PubChem CID | 16869606 |
| Molecular Formula | C19H16ClNO3S |
| Molecular Weight | 373.86 g/mol |
| Exact Mass | 373.05 |
| IUPAC Name | [5-(4-chlorophenyl)-1,2-oxazol-3-yl]methyl 2-benzylsulfanylacetate |
| SMILES | O=C(CSCc1ccccc1)OCc1cc(-c2ccc(Cl)cc2)on1 |
| InChI | InChI=1S/C19H16ClNO3S/c20-16-8-6-15(7-9-16)18-10-17(21-24-18)11-23-19(22)13-25-12-14-4-2-1-3-5-14/h1-10H,11-13H2 |
| InChIKey | SXYIESHEUXBULP-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.86 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |