C22H21F3N4O2 — CID 55755016
5-methyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-1-phenyl-N-propylpyrazole-3-carboxamide (PubChem CID 55755016) has the molecular formula C22H21F3N4O2 and a molecular weight of 430.43 g/mol. Its IUPAC name is 5-methyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-1-phenyl-N-propylpyrazole-3-carboxamide.
| Compound Name | 5-methyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-1-phenyl-N-propylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 55755016 |
| Molecular Formula | C22H21F3N4O2 |
| Molecular Weight | 430.43 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | 5-methyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-1-phenyl-N-propylpyrazole-3-carboxamide |
| SMILES | CCCN(CC(=O)Nc1ccc(F)c(F)c1F)C(=O)c1cc(C)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C22H21F3N4O2/c1-3-11-28(13-19(30)26-17-10-9-16(23)20(24)21(17)25)22(31)18-12-14(2)29(27-18)15-7-5-4-6-8-15/h4-10,12H,3,11,13H2,1-2H3,(H,26,30) |
| InChIKey | VKHDSZISNANSNL-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.43 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|