C25H28F3N5O2 — CID 55482520
N-(3,5-dimethyl-1-phenylpyrazol-4-yl)-3-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-propylamino]propanamide (PubChem CID 55482520) has the molecular formula C25H28F3N5O2 and a molecular weight of 487.53 g/mol. Its IUPAC name is N-(3,5-dimethyl-1-phenylpyrazol-4-yl)-3-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-propylamino]propanamide.
| Compound Name | N-(3,5-dimethyl-1-phenylpyrazol-4-yl)-3-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-propylamino]propanamide |
|---|---|
| PubChem CID | 55482520 |
| Molecular Formula | C25H28F3N5O2 |
| Molecular Weight | 487.53 g/mol |
| Exact Mass | 487.22 |
| IUPAC Name | N-(3,5-dimethyl-1-phenylpyrazol-4-yl)-3-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-propylamino]propanamide |
| SMILES | CCCN(CCC(=O)Nc1c(C)nn(-c2ccccc2)c1C)CC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C25H28F3N5O2/c1-4-13-32(15-22(35)29-20-11-10-19(26)23(27)24(20)28)14-12-21(34)30-25-16(2)31-33(17(25)3)18-8-6-5-7-9-18/h5-11H,4,12-15H2,1-3H3,(H,29,35)(H,30,34) |
| InChIKey | ZNNWCQCTPWWAOZ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.53 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|