C24H26F3N5O2 — CID 24566252
2-[[2-[methyl-[(1-phenylpyrazol-4-yl)methyl]amino]-2-oxoethyl]-propylamino]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 24566252) has the molecular formula C24H26F3N5O2 and a molecular weight of 473.50 g/mol. Its IUPAC name is 2-[[2-[methyl-[(1-phenylpyrazol-4-yl)methyl]amino]-2-oxoethyl]-propylamino]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[[2-[methyl-[(1-phenylpyrazol-4-yl)methyl]amino]-2-oxoethyl]-propylamino]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 24566252 |
| Molecular Formula | C24H26F3N5O2 |
| Molecular Weight | 473.50 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | 2-[[2-[methyl-[(1-phenylpyrazol-4-yl)methyl]amino]-2-oxoethyl]-propylamino]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | CCCN(CC(=O)Nc1ccc(F)c(F)c1F)CC(=O)N(C)Cc1cnn(-c2ccccc2)c1 |
| InChI | InChI=1S/C24H26F3N5O2/c1-3-11-31(15-21(33)29-20-10-9-19(25)23(26)24(20)27)16-22(34)30(2)13-17-12-28-32(14-17)18-7-5-4-6-8-18/h4-10,12,14H,3,11,13,15-16H2,1-2H3,(H,29,33) |
| InChIKey | POJMTEMOKHPZAF-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.50 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|