C21H19F3N4O2 — CID 27773162
N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-1-phenyl-N-propylpyrazole-4-carboxamide (PubChem CID 27773162) has the molecular formula C21H19F3N4O2 and a molecular weight of 416.40 g/mol. Its IUPAC name is N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-1-phenyl-N-propylpyrazole-4-carboxamide.
| Compound Name | N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-1-phenyl-N-propylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 27773162 |
| Molecular Formula | C21H19F3N4O2 |
| Molecular Weight | 416.40 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-1-phenyl-N-propylpyrazole-4-carboxamide |
| SMILES | CCCN(CC(=O)Nc1ccc(F)c(F)c1F)C(=O)c1cnn(-c2ccccc2)c1 |
| InChI | InChI=1S/C21H19F3N4O2/c1-2-10-27(13-18(29)26-17-9-8-16(22)19(23)20(17)24)21(30)14-11-25-28(12-14)15-6-4-3-5-7-15/h3-9,11-12H,2,10,13H2,1H3,(H,26,29) |
| InChIKey | DMWXKKKFSUMKMF-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.40 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|