C18H25F3N4O2 — CID 120980373
2-[(3-oxo-3-piperazin-1-ylpropyl)-propylamino]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 120980373) has the molecular formula C18H25F3N4O2 and a molecular weight of 386.42 g/mol. Its IUPAC name is 2-[(3-oxo-3-piperazin-1-ylpropyl)-propylamino]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[(3-oxo-3-piperazin-1-ylpropyl)-propylamino]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 120980373 |
| Molecular Formula | C18H25F3N4O2 |
| Molecular Weight | 386.42 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | 2-[(3-oxo-3-piperazin-1-ylpropyl)-propylamino]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | CCCN(CCC(=O)N1CCNCC1)CC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C18H25F3N4O2/c1-2-8-24(9-5-16(27)25-10-6-22-7-11-25)12-15(26)23-14-4-3-13(19)17(20)18(14)21/h3-4,22H,2,5-12H2,1H3,(H,23,26) |
| InChIKey | BJYVAFCXIJTJFW-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.42 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|