C20H19F5N2O4 — CID 112790031
2-(difluoromethoxy)-3-methoxy-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-N-propylbenzamide (PubChem CID 112790031) has the molecular formula C20H19F5N2O4 and a molecular weight of 446.37 g/mol. Its IUPAC name is 2-(difluoromethoxy)-3-methoxy-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-N-propylbenzamide.
| Compound Name | 2-(difluoromethoxy)-3-methoxy-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-N-propylbenzamide |
|---|---|
| PubChem CID | 112790031 |
| Molecular Formula | C20H19F5N2O4 |
| Molecular Weight | 446.37 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | 2-(difluoromethoxy)-3-methoxy-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-N-propylbenzamide |
| SMILES | CCCN(CC(=O)Nc1ccc(F)c(F)c1F)C(=O)c1cccc(OC)c1OC(F)F |
| InChI | InChI=1S/C20H19F5N2O4/c1-3-9-27(10-15(28)26-13-8-7-12(21)16(22)17(13)23)19(29)11-5-4-6-14(30-2)18(11)31-20(24)25/h4-8,20H,3,9-10H2,1-2H3,(H,26,28) |
| InChIKey | SAQRCIJLGVQKGL-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.37 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|