C22H25F3N2O4 — CID 29403471
2-[[2-(2-propoxyphenoxy)acetyl]-propylamino]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 29403471) has the molecular formula C22H25F3N2O4 and a molecular weight of 438.45 g/mol. Its IUPAC name is 2-[[2-(2-propoxyphenoxy)acetyl]-propylamino]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[[2-(2-propoxyphenoxy)acetyl]-propylamino]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 29403471 |
| Molecular Formula | C22H25F3N2O4 |
| Molecular Weight | 438.45 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | 2-[[2-(2-propoxyphenoxy)acetyl]-propylamino]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | CCCOc1ccccc1OCC(=O)N(CCC)CC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C22H25F3N2O4/c1-3-11-27(13-19(28)26-16-10-9-15(23)21(24)22(16)25)20(29)14-31-18-8-6-5-7-17(18)30-12-4-2/h5-10H,3-4,11-14H2,1-2H3,(H,26,28) |
| InChIKey | MZKMUGVBTKKRGP-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.45 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|