C20H20F3N3O5 — CID 46554944
4-ethoxy-3-nitro-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-N-propylbenzamide (PubChem CID 46554944) has the molecular formula C20H20F3N3O5 and a molecular weight of 439.39 g/mol. Its IUPAC name is 4-ethoxy-3-nitro-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-N-propylbenzamide.
| Compound Name | 4-ethoxy-3-nitro-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-N-propylbenzamide |
|---|---|
| PubChem CID | 46554944 |
| Molecular Formula | C20H20F3N3O5 |
| Molecular Weight | 439.39 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | 4-ethoxy-3-nitro-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-N-propylbenzamide |
| SMILES | CCCN(CC(=O)Nc1ccc(F)c(F)c1F)C(=O)c1ccc(OCC)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H20F3N3O5/c1-3-9-25(11-17(27)24-14-7-6-13(21)18(22)19(14)23)20(28)12-5-8-16(31-4-2)15(10-12)26(29)30/h5-8,10H,3-4,9,11H2,1-2H3,(H,24,27) |
| InChIKey | LREVERYWYTURMB-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.39 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|