C22H31F3N4O3 — CID 55515505
4-(cyclohexylcarbamoylamino)-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-N-propylbutanamide (PubChem CID 55515505) has the molecular formula C22H31F3N4O3 and a molecular weight of 456.51 g/mol. Its IUPAC name is 4-(cyclohexylcarbamoylamino)-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-N-propylbutanamide.
| Compound Name | 4-(cyclohexylcarbamoylamino)-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-N-propylbutanamide |
|---|---|
| PubChem CID | 55515505 |
| Molecular Formula | C22H31F3N4O3 |
| Molecular Weight | 456.51 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | 4-(cyclohexylcarbamoylamino)-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-N-propylbutanamide |
| SMILES | CCCN(CC(=O)Nc1ccc(F)c(F)c1F)C(=O)CCCNC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C22H31F3N4O3/c1-2-13-29(14-18(30)28-17-11-10-16(23)20(24)21(17)25)19(31)9-6-12-26-22(32)27-15-7-4-3-5-8-15/h10-11,15H,2-9,12-14H2,1H3,(H,28,30)(H2,26,27,32) |
| InChIKey | BSLMZUOOUUJMDN-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.51 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|