C17H22F3N3O — CID 100836482
3-[(1S,8S)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]-1-methyl-1-[[2-(trifluoromethyl)phenyl]methyl]urea (PubChem CID 100836482) has the molecular formula C17H22F3N3O and a molecular weight of 341.38 g/mol. Its IUPAC name is 3-[(1S,8S)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]-1-methyl-1-[[2-(trifluoromethyl)phenyl]methyl]urea.
| Compound Name | 3-[(1S,8S)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]-1-methyl-1-[[2-(trifluoromethyl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 100836482 |
| Molecular Formula | C17H22F3N3O |
| Molecular Weight | 341.38 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | 3-[(1S,8S)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]-1-methyl-1-[[2-(trifluoromethyl)phenyl]methyl]urea |
| SMILES | CN(Cc1ccccc1C(F)(F)F)C(=O)N[C@H]1CCN2CCC[C@@H]12 |
| InChI | InChI=1S/C17H22F3N3O/c1-22(11-12-5-2-3-6-13(12)17(18,19)20)16(24)21-14-8-10-23-9-4-7-15(14)23/h2-3,5-6,14-15H,4,7-11H2,1H3,(H,21,24)/t14-,15-/m0/s1 |
| InChIKey | QMLOPPMYHXIREX-GJZGRUSLSA-N |
| XLogP | 3.08 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.38 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |