C18H25F2N3O — CID 97082093
3-[(1S,8aR)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-1-benzyl-1-(2,2-difluoroethyl)urea (PubChem CID 97082093) has the molecular formula C18H25F2N3O and a molecular weight of 337.41 g/mol. Its IUPAC name is 3-[(1S,8aR)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-1-benzyl-1-(2,2-difluoroethyl)urea.
| Compound Name | 3-[(1S,8aR)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-1-benzyl-1-(2,2-difluoroethyl)urea |
|---|---|
| PubChem CID | 97082093 |
| Molecular Formula | C18H25F2N3O |
| Molecular Weight | 337.41 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | 3-[(1S,8aR)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-1-benzyl-1-(2,2-difluoroethyl)urea |
| SMILES | O=C(N[C@H]1CCN2CCCC[C@H]12)N(Cc1ccccc1)CC(F)F |
| InChI | InChI=1S/C18H25F2N3O/c19-17(20)13-23(12-14-6-2-1-3-7-14)18(24)21-15-9-11-22-10-5-4-8-16(15)22/h1-3,6-7,15-17H,4-5,8-13H2,(H,21,24)/t15-,16+/m0/s1 |
| InChIKey | NNJZJOMJBUBAME-JKSUJKDBSA-N |
| XLogP | 3.09 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.41 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |