C19H27N3O3 — CID 100857771
3-[(1R,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-1-(1,3-benzodioxol-5-ylmethyl)-1-ethylurea (PubChem CID 100857771) has the molecular formula C19H27N3O3 and a molecular weight of 345.44 g/mol. Its IUPAC name is 3-[(1R,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-1-(1,3-benzodioxol-5-ylmethyl)-1-ethylurea.
| Compound Name | 3-[(1R,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-1-(1,3-benzodioxol-5-ylmethyl)-1-ethylurea |
|---|---|
| PubChem CID | 100857771 |
| Molecular Formula | C19H27N3O3 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | 3-[(1R,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-1-(1,3-benzodioxol-5-ylmethyl)-1-ethylurea |
| SMILES | CCN(Cc1ccc2c(c1)OCO2)C(=O)N[C@@H]1CCN2CCCC[C@@H]12 |
| InChI | InChI=1S/C19H27N3O3/c1-2-21(12-14-6-7-17-18(11-14)25-13-24-17)19(23)20-15-8-10-22-9-4-3-5-16(15)22/h6-7,11,15-16H,2-5,8-10,12-13H2,1H3,(H,20,23)/t15-,16+/m1/s1 |
| InChIKey | CYEFEZVMEPKYII-CVEARBPZSA-N |
| XLogP | 2.57 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |