C21H26N4O3 — CID 55808906
1-(1,3-benzodioxol-5-ylmethyl)-1-ethyl-3-(1-pyridin-2-ylpiperidin-4-yl)urea (PubChem CID 55808906) has the molecular formula C21H26N4O3 and a molecular weight of 382.46 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-1-ethyl-3-(1-pyridin-2-ylpiperidin-4-yl)urea.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-1-ethyl-3-(1-pyridin-2-ylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 55808906 |
| Molecular Formula | C21H26N4O3 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-1-ethyl-3-(1-pyridin-2-ylpiperidin-4-yl)urea |
| SMILES | CCN(Cc1ccc2c(c1)OCO2)C(=O)NC1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C21H26N4O3/c1-2-24(14-16-6-7-18-19(13-16)28-15-27-18)21(26)23-17-8-11-25(12-9-17)20-5-3-4-10-22-20/h3-7,10,13,17H,2,8-9,11-12,14-15H2,1H3,(H,23,26) |
| InChIKey | VMQPBOCDSPQIPX-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |