C23H30N4O3 — CID 55808937
1-[(2-hydroxyphenyl)methyl]-1-(oxolan-2-ylmethyl)-3-(1-pyridin-2-ylpiperidin-4-yl)urea (PubChem CID 55808937) has the molecular formula C23H30N4O3 and a molecular weight of 410.52 g/mol. Its IUPAC name is 1-[(2-hydroxyphenyl)methyl]-1-(oxolan-2-ylmethyl)-3-(1-pyridin-2-ylpiperidin-4-yl)urea.
| Compound Name | 1-[(2-hydroxyphenyl)methyl]-1-(oxolan-2-ylmethyl)-3-(1-pyridin-2-ylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 55808937 |
| Molecular Formula | C23H30N4O3 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | 1-[(2-hydroxyphenyl)methyl]-1-(oxolan-2-ylmethyl)-3-(1-pyridin-2-ylpiperidin-4-yl)urea |
| SMILES | O=C(NC1CCN(c2ccccn2)CC1)N(Cc1ccccc1O)CC1CCCO1 |
| InChI | InChI=1S/C23H30N4O3/c28-21-8-2-1-6-18(21)16-27(17-20-7-5-15-30-20)23(29)25-19-10-13-26(14-11-19)22-9-3-4-12-24-22/h1-4,6,8-9,12,19-20,28H,5,7,10-11,13-17H2,(H,25,29) |
| InChIKey | QRGVNZVKHZMHRH-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 77.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|