C24H30N2O5 — CID 95303946
1-[(2-hydroxyphenyl)methyl]-3-[3-[[(2R)-oxolan-2-yl]methoxy]phenyl]-1-[[(2S)-oxolan-2-yl]methyl]urea (PubChem CID 95303946) has the molecular formula C24H30N2O5 and a molecular weight of 426.51 g/mol. Its IUPAC name is 1-[(2-hydroxyphenyl)methyl]-3-[3-[[(2R)-oxolan-2-yl]methoxy]phenyl]-1-[[(2S)-oxolan-2-yl]methyl]urea.
| Compound Name | 1-[(2-hydroxyphenyl)methyl]-3-[3-[[(2R)-oxolan-2-yl]methoxy]phenyl]-1-[[(2S)-oxolan-2-yl]methyl]urea |
|---|---|
| PubChem CID | 95303946 |
| Molecular Formula | C24H30N2O5 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | 1-[(2-hydroxyphenyl)methyl]-3-[3-[[(2R)-oxolan-2-yl]methoxy]phenyl]-1-[[(2S)-oxolan-2-yl]methyl]urea |
| SMILES | O=C(Nc1cccc(OC[C@H]2CCCO2)c1)N(Cc1ccccc1O)C[C@@H]1CCCO1 |
| InChI | InChI=1S/C24H30N2O5/c27-23-11-2-1-6-18(23)15-26(16-21-9-4-12-29-21)24(28)25-19-7-3-8-20(14-19)31-17-22-10-5-13-30-22/h1-3,6-8,11,14,21-22,27H,4-5,9-10,12-13,15-17H2,(H,25,28)/t21-,22+/m0/s1 |
| InChIKey | ZUOYWVJTGOCIAH-FCHUYYIVSA-N |
| XLogP | 4.16 |
| TPSA | 80.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|