C16H26F3N3O — CID 71974453
3-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-1-(cyclopropylmethyl)-1-(3,3,3-trifluoropropyl)urea (PubChem CID 71974453) has the molecular formula C16H26F3N3O and a molecular weight of 333.40 g/mol. Its IUPAC name is 3-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-1-(cyclopropylmethyl)-1-(3,3,3-trifluoropropyl)urea.
| Compound Name | 3-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-1-(cyclopropylmethyl)-1-(3,3,3-trifluoropropyl)urea |
|---|---|
| PubChem CID | 71974453 |
| Molecular Formula | C16H26F3N3O |
| Molecular Weight | 333.40 g/mol |
| Exact Mass | 333.20 |
| IUPAC Name | 3-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-1-(cyclopropylmethyl)-1-(3,3,3-trifluoropropyl)urea |
| SMILES | O=C(NC1CCN2CCCCC12)N(CCC(F)(F)F)CC1CC1 |
| InChI | InChI=1S/C16H26F3N3O/c17-16(18,19)7-10-22(11-12-4-5-12)15(23)20-13-6-9-21-8-2-1-3-14(13)21/h12-14H,1-11H2,(H,20,23) |
| InChIKey | HILXCUYLIQNYJQ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.40 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |