C18H29N3O3 — CID 100876976
3-[(1R,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-1-(2-methoxyethyl)-1-[(5-methylfuran-2-yl)methyl]urea (PubChem CID 100876976) has the molecular formula C18H29N3O3 and a molecular weight of 335.45 g/mol. Its IUPAC name is 3-[(1R,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-1-(2-methoxyethyl)-1-[(5-methylfuran-2-yl)methyl]urea.
| Compound Name | 3-[(1R,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-1-(2-methoxyethyl)-1-[(5-methylfuran-2-yl)methyl]urea |
|---|---|
| PubChem CID | 100876976 |
| Molecular Formula | C18H29N3O3 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.22 |
| IUPAC Name | 3-[(1R,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-1-(2-methoxyethyl)-1-[(5-methylfuran-2-yl)methyl]urea |
| SMILES | COCCN(Cc1ccc(C)o1)C(=O)N[C@@H]1CCN2CCCC[C@@H]12 |
| InChI | InChI=1S/C18H29N3O3/c1-14-6-7-15(24-14)13-21(11-12-23-2)18(22)19-16-8-10-20-9-4-3-5-17(16)20/h6-7,16-17H,3-5,8-13H2,1-2H3,(H,19,22)/t16-,17+/m1/s1 |
| InChIKey | HAVZRFNTODNNRB-SJORKVTESA-N |
| XLogP | 2.37 |
| TPSA | 57.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |