C20H24N2O3 — CID 100839263
N-[(1R,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-5-(phenoxymethyl)furan-2-carboxamide (PubChem CID 100839263) has the molecular formula C20H24N2O3 and a molecular weight of 340.42 g/mol. Its IUPAC name is N-[(1R,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-5-(phenoxymethyl)furan-2-carboxamide.
| Compound Name | N-[(1R,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-5-(phenoxymethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 100839263 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | N-[(1R,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-5-(phenoxymethyl)furan-2-carboxamide |
| SMILES | O=C(N[C@@H]1CCN2CCCC[C@@H]12)c1ccc(COc2ccccc2)o1 |
| InChI | InChI=1S/C20H24N2O3/c23-20(21-17-11-13-22-12-5-4-8-18(17)22)19-10-9-16(25-19)14-24-15-6-2-1-3-7-15/h1-3,6-7,9-10,17-18H,4-5,8,11-14H2,(H,21,23)/t17-,18+/m1/s1 |
| InChIKey | UJVCTZNSUGGYGT-MSOLQXFVSA-N |
| XLogP | 3.22 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |