C19H23NO3 — CID 31462340
N-[(1S,2S)-2-methylcyclohexyl]-5-(phenoxymethyl)furan-2-carboxamide (PubChem CID 31462340) has the molecular formula C19H23NO3 and a molecular weight of 313.40 g/mol. Its IUPAC name is N-[(1S,2S)-2-methylcyclohexyl]-5-(phenoxymethyl)furan-2-carboxamide.
| Compound Name | N-[(1S,2S)-2-methylcyclohexyl]-5-(phenoxymethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 31462340 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | N-[(1S,2S)-2-methylcyclohexyl]-5-(phenoxymethyl)furan-2-carboxamide |
| SMILES | C[C@H]1CCCC[C@@H]1NC(=O)c1ccc(COc2ccccc2)o1 |
| InChI | InChI=1S/C19H23NO3/c1-14-7-5-6-10-17(14)20-19(21)18-12-11-16(23-18)13-22-15-8-3-2-4-9-15/h2-4,8-9,11-12,14,17H,5-7,10,13H2,1H3,(H,20,21)/t14-,17-/m0/s1 |
| InChIKey | SCOLMFXCNQCHJM-YOEHRIQHSA-N |
| XLogP | 4.17 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |